---
title: Predict small molecule ADME | Boltz API Docs
description: Predict Tier-1 ADME summary properties (lipophilicity, permeability, and solubility) for a batch of small molecules by SMILES.
---

ADME prediction scores a batch of small molecules for Tier-1 ADME summary properties (lipophilicity, permeability, and solubility) directly from SMILES. You submit a list of molecules and get back one result object with a per-molecule summary, returned in the same order you submitted them. It runs to completion and cannot be paused or stopped.

## Run

`run()` submits the batch, waits for it to finish, and writes the completed prediction to a local run directory (returning its `Path`). Use `start()` + `retrieve()` to submit now and poll yourself, working with the prediction object in-memory.

- [Python](#tab-panel-0-0)
- [CLI](#tab-panel-0-1)
- [TypeScript](#tab-panel-0-2)

```
import os
import time
from boltz_api import Boltz


client = Boltz(
    base_url="https://api.boltz.bio",
    api_key=os.environ["BOLTZ_API_KEY"])


adme_input = {
    "molecules": [
        {"smiles": "CC(=O)OC1=CC=CC=C1C(=O)O", "id": "aspirin"},
        {"smiles": "CC(C)Cc1ccc(cc1)C(C)C(=O)O", "id": "ibuprofen"},
    ],
}  # see Input format for the molecule fields


# One call: submit, poll, and write the finished prediction to a local run directory.
# Returns a Path; the API response is mirrored on disk in `run.json`.
run_dir = client.predictions.adme.run(model="adme-v1", input=adme_input)


# ...or submit now and poll yourself with start() + retrieve():
prediction = client.predictions.adme.start(model="adme-v1", input=adme_input)
while prediction.status not in ("succeeded", "failed"):
    time.sleep(5)
    prediction = client.predictions.adme.retrieve(prediction.id)


# Read the per-molecule ADME summary from the prediction object (start() + retrieve() branch above;
# for the run() branch the same response is on disk at run_dir / "run.json"):
for m in prediction.output.molecules:
    if m.status == "succeeded":
        print(f"{m.external_id or m.id}  logD={m.adme.lipophilicity:.2f}  perm={m.adme.permeability:.2f}  sol={m.adme.solubility}")
    else:
        print(f"{m.external_id or m.id}  failed: {m.error.message}")
```

Write your molecules to `adme-input.yaml` (see [Input format](#input-format)), submit, then retrieve the result (rerun `retrieve` until `status` is `succeeded`):

Terminal window

```
export BOLTZ_BASE_URL="https://api.boltz.bio"
PREDICTION_ID=$(
  boltz-api --format raw predictions:adme start \
    --model adme-v1 --input @yaml://./adme-input.yaml | jq -r '.id'
)


boltz-api predictions:adme retrieve --id "$PREDICTION_ID"
```

`start()` returns immediately; poll `retrieve()` until the prediction finishes, then read `output.molecules`.

```
import Boltz from "boltz-api";


const client = new Boltz({
  baseURL: "https://api.boltz.bio",
  apiKey: process.env["BOLTZ_API_KEY"] });


let prediction = await client.predictions.adme.start({
  model: "adme-v1",
  input: {
    molecules: [
      { smiles: "CC(=O)OC1=CC=CC=C1C(=O)O", id: "aspirin" },
      { smiles: "CC(C)Cc1ccc(cc1)C(C)C(=O)O", id: "ibuprofen" },
    ],
  },
});


while (prediction.status !== "succeeded" && prediction.status !== "failed") {
  await new Promise((r) => setTimeout(r, 5000));
  prediction = await client.predictions.adme.retrieve(prediction.id);
}


if (prediction.status === "succeeded") {
  for (const m of prediction.output.molecules) {
    if (m.status === "succeeded") {
      console.log(`${m.external_id ?? m.id}  logD=${m.adme.lipophilicity}  perm=${m.adme.permeability}  sol=${m.adme.solubility}`);
    } else {
      console.log(`${m.external_id ?? m.id}  failed: ${m.error.message}`);
    }
  }
}
```

## Input format

A prediction takes a batch of **molecules** to score, given by SMILES, passed as the `input` body. The **model** (`adme-v1`) is a separate argument. The example below is a complete, valid `input`.

Copy

```
{
  "molecules": [
    # your batch to score; each needs "smiles". optional "id" is returned as
    # "external_id" on the matching result so you can correlate back to your list
    { "smiles": "CC(=O)OC1=CC=CC=C1C(=O)O", "id": "aspirin" },
    { "smiles": "CC(C)Cc1ccc(cc1)C(C)C(=O)O", "id": "ibuprofen" },
    { "smiles": "CN1C=NC2=C1C(=O)N(C(=O)N2C)C" }
  ]
}
```

| Field       | Required | What it is                               | Link                              |
| ----------- | -------- | ---------------------------------------- | --------------------------------- |
| `molecules` | Yes      | The molecules to score, given by SMILES. | [Molecules](#molecules-molecules) |

### Molecules (`molecules`)

`molecules` is the batch you want to score, given inline as an array. Send 1 to 128 molecules per request. Each entry needs a `smiles` string and may carry an optional `id`. When you provide an `id`, it comes back as `external_id` on the matching result, so you can correlate results to your input. Results are returned in the same order as this list.

## Output format

A prediction returns a single object; there’s no streaming page of results, and nothing to download, since ADME values are returned inline. Poll its `status`; `output` is `null` until the prediction succeeds, then carries a per-molecule summary. Each molecule reports `status: "succeeded"` with an `adme` summary, or `status: "failed"` with a non-null `error` (the rest of the batch still succeeds).

Copy

```
{
  "id": "adme_pred_8f3a2b",
  "status": "succeeded", # pending | running | succeeded | failed
  "model": "adme-v1",
  "version": "1.0.0", # model version used for this prediction
  "error": None, # { code, message } once status is "failed"
  "output": { # null until status is "succeeded"
    "molecules": [
      # one entry per input molecule, in the same order you submitted them
      {
        "id": "adme_mol_001", # internally generated molecule ID
        "external_id": "aspirin", # the "id" you supplied, if any
        "smiles": "CC(=O)OC1=CC=CC=C1C(=O)O", # echoed from the request
        "status": "succeeded", # succeeded | failed
        "adme": { # Tier-1 ADME summary (null when this molecule failed)
          "lipophilicity": 1.2, # LogD-based lipophilicity score
          "permeability": 0.61, # permeability score
          "solubility": "medium-confidence" # high-confidence | medium-confidence | high-risk
        },
        "error": None
      },
      {
        "id": "adme_mol_003",
        "smiles": "not-a-valid-smiles",
        "status": "failed", # this molecule errored; "adme" is null
        "adme": None,
        "error": { "code": "invalid_smiles", "message": "Could not parse SMILES" }
      }
    ]
  },
  "livemode": True, # false for predictions created with a test key
  "workspace_id": "ws_3a2b",
  "created_at": "2026-02-25T12:00:00Z",
  "started_at": "2026-02-25T12:00:05Z",
  "completed_at": "2026-02-25T12:00:20Z",
  "expires_at": "2026-03-04T12:00:20Z", # when this resource and its data are deleted
  "data_deleted_at": None # set once the data is deleted
  # "input" echoes the request you submitted (null after data deletion)
}
```

Metric values shown in this guide are illustrative. ADME values are summary judgements intended for triage and ranking, not absolute measurements.

## Properties

| Property        | Range / values                                        | What it measures                                                                                                                                                                                                                                                                                                                         |
| --------------- | ----------------------------------------------------- | ---------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------- |
| `lipophilicity` | number                                                | Lipophilicity from the internal LogD prediction; higher is more lipophilic.                                                                                                                                                                                                                                                              |
| `permeability`  | number                                                | Permeability score for the molecule.                                                                                                                                                                                                                                                                                                     |
| `solubility`    | `high-confidence` · `medium-confidence` · `high-risk` | Flag for triage based on predicted aqueous solubility. `high-confidence` compounds are likely to be highly soluble with LogS >= -4. `high-confidence` and `medium-confidence` compounds are likely to be at least partially soluble with LogS >= -5. The `high-risk` bin is intended to capture most insoluble compounds with LogS < -5. |

## Status values

| Status      | Meaning                                                                                                     |
| ----------- | ----------------------------------------------------------------------------------------------------------- |
| `pending`   | The prediction is queued and has not started yet.                                                           |
| `running`   | The prediction is currently being computed.                                                                 |
| `succeeded` | The prediction finished. Read `output.molecules`; individual molecules may still report `status: "failed"`. |
| `failed`    | The whole prediction errored. Check the `error` field.                                                      |
